C23H21NO6 — CID 2639458
(5-acetyl-2-ethoxyphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 2639458) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2639458 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCc3cc(C(C)=O)ccc3OCC)cc2C1=O |
| InChI | InChI=1S/C23H21NO6/c1-4-10-24-21(26)18-8-6-16(12-19(18)22(24)27)23(28)30-13-17-11-15(14(3)25)7-9-20(17)29-5-2/h4,6-9,11-12H,1,5,10,13H2,2-3H3 |
| InChIKey | ABBXZMZHERGYIC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|