C25H16N2O6 — CID 4020226
(1,3-dioxoisoindol-2-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4020226) has the molecular formula C25H16N2O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4020226 |
| Molecular Formula | C25H16N2O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C25H16N2O6/c28-21-19-11-10-16(12-20(19)24(31)26(21)13-15-6-2-1-3-7-15)25(32)33-14-27-22(29)17-8-4-5-9-18(17)23(27)30/h1-12H,13-14H2 |
| InChIKey | WCHNLHUYQNUHIY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|