C26H19N3O6 — CID 55355977
[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55355977) has the molecular formula C26H19N3O6 and a molecular weight of 469.45 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55355977 |
| Molecular Formula | C26H19N3O6 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccccc1-c1noc(COC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)n1 |
| InChI | InChI=1S/C26H19N3O6/c1-33-21-10-6-5-9-19(21)23-27-22(35-28-23)15-34-26(32)17-11-12-18-20(13-17)25(31)29(24(18)30)14-16-7-3-2-4-8-16/h2-13H,14-15H2,1H3 |
| InChIKey | IJDFDKFQFMENDC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|