C18H9Cl4N3O4 — CID 43018907
4,5,6,7-tetrachloro-2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione (PubChem CID 43018907) has the molecular formula C18H9Cl4N3O4 and a molecular weight of 473.10 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 43018907 |
| Molecular Formula | C18H9Cl4N3O4 |
| Molecular Weight | 473.10 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccccc1-c1noc(CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)n1 |
| InChI | InChI=1S/C18H9Cl4N3O4/c1-28-8-5-3-2-4-7(8)16-23-9(29-24-16)6-25-17(26)10-11(18(25)27)13(20)15(22)14(21)12(10)19/h2-5H,6H2,1H3 |
| InChIKey | WOQPFXDHAQJJNV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|