C20H17N5O6 — CID 55376162
3-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 55376162) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is 3-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55376162 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccccc1-c1noc(CN2C(=O)NC(C)(c3ccc([N+](=O)[O-])cc3)C2=O)n1 |
| InChI | InChI=1S/C20H17N5O6/c1-20(12-7-9-13(10-8-12)25(28)29)18(26)24(19(27)22-20)11-16-21-17(23-31-16)14-5-3-4-6-15(14)30-2/h3-10H,11H2,1-2H3,(H,22,27) |
| InChIKey | KDTOEKYKZARCNG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|