C17H13N5O5S — CID 43075754
5-methyl-5-(3-nitrophenyl)-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 43075754) has the molecular formula C17H13N5O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is 5-methyl-5-(3-nitrophenyl)-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(3-nitrophenyl)-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43075754 |
| Molecular Formula | C17H13N5O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 5-methyl-5-(3-nitrophenyl)-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)NC(=O)N(Cc2nc(-c3ccsc3)no2)C1=O |
| InChI | InChI=1S/C17H13N5O5S/c1-17(11-3-2-4-12(7-11)22(25)26)15(23)21(16(24)19-17)8-13-18-14(20-27-13)10-5-6-28-9-10/h2-7,9H,8H2,1H3,(H,19,24) |
| InChIKey | SUKBMKCNHSOFTQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|