C24H17N5O5 — CID 39061235
3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 39061235) has the molecular formula C24H17N5O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is 3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39061235 |
| Molecular Formula | C24H17N5O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C24H17N5O5/c30-22-24(17-9-3-1-4-10-17,18-11-5-2-6-12-18)26-23(31)28(22)15-20-25-21(27-34-20)16-8-7-13-19(14-16)29(32)33/h1-14H,15H2,(H,26,31) |
| InChIKey | LPZVFXXVRDANFD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|