C25H19N5O5 — CID 112828506
1-benzyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 112828506) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-benzyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1-benzyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112828506 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-benzyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1C(c2ccccc2)N(Cc2ccccc2)C(=O)N1Cc1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C25H19N5O5/c31-24-22(18-10-5-2-6-11-18)28(15-17-8-3-1-4-9-17)25(32)29(24)16-21-26-23(27-35-21)19-12-7-13-20(14-19)30(33)34/h1-14,22H,15-16H2 |
| InChIKey | JUCWOLXZYVLRTG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 122.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|