C14H18ClN5O3 — CID 119906393
5-(1,4-diazepan-1-ylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 119906393) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-(1,4-diazepan-1-ylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 119906393 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-(1,4-diazepan-1-ylmethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(-c2noc(CN3CCCNCC3)n2)c1 |
| InChI | InChI=1S/C14H17N5O3.ClH/c20-19(21)12-4-1-3-11(9-12)14-16-13(22-17-14)10-18-7-2-5-15-6-8-18;/h1,3-4,9,15H,2,5-8,10H2;1H |
| InChIKey | FLRUOYKQMFFTNL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|