C20H15F2N5O6 — CID 55604328
5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione (PubChem CID 55604328) has the molecular formula C20H15F2N5O6 and a molecular weight of 459.37 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55604328 |
| Molecular Formula | C20H15F2N5O6 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(Cc2nc(-c3cccc([N+](=O)[O-])c3)no2)C1=O |
| InChI | InChI=1S/C20H15F2N5O6/c1-20(12-5-7-14(8-6-12)32-18(21)22)17(28)26(19(29)24-20)10-15-23-16(25-33-15)11-3-2-4-13(9-11)27(30)31/h2-9,18H,10H2,1H3,(H,24,29) |
| InChIKey | SOCASXVLRGKCFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|