C22H21ClN4O3 — CID 24521701
3-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione (PubChem CID 24521701) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is 3-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24521701 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(Cc3nc(-c4cccc(Cl)c4)no3)C2=O)cc1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-3-5-14-8-10-16(11-9-14)22(2)20(28)27(21(29)25-22)13-18-24-19(26-30-18)15-6-4-7-17(23)12-15/h4,6-12H,3,5,13H2,1-2H3,(H,25,29) |
| InChIKey | JJDSBYPEOZRUBL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|