C17H13ClN4O3S — CID 51227978
5-(4-chlorophenyl)-5-methyl-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 51227978) has the molecular formula C17H13ClN4O3S and a molecular weight of 388.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-5-methyl-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-5-methyl-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51227978 |
| Molecular Formula | C17H13ClN4O3S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-(4-chlorophenyl)-5-methyl-3-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2)NC(=O)N(Cc2nc(-c3ccsc3)no2)C1=O |
| InChI | InChI=1S/C17H13ClN4O3S/c1-17(11-2-4-12(18)5-3-11)15(23)22(16(24)20-17)8-13-19-14(21-25-13)10-6-7-26-9-10/h2-7,9H,8H2,1H3,(H,20,24) |
| InChIKey | SDQMXUVBSMLBGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|