C21H19N5O6 — CID 43075788
3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 43075788) has the molecular formula C21H19N5O6 and a molecular weight of 437.41 g/mol. Its IUPAC name is 3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43075788 |
| Molecular Formula | C21H19N5O6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-(3-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CCOc1ccc(-c2noc(CN3C(=O)NC(C)(c4cccc([N+](=O)[O-])c4)C3=O)n2)cc1 |
| InChI | InChI=1S/C21H19N5O6/c1-3-31-16-9-7-13(8-10-16)18-22-17(32-24-18)12-25-19(27)21(2,23-20(25)28)14-5-4-6-15(11-14)26(29)30/h4-11H,3,12H2,1-2H3,(H,23,28) |
| InChIKey | HGUNCDPOPGSMFI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|