C21H18FN3O4 — CID 24585145
5-(4-fluorophenyl)-3-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 24585145) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-3-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24585145 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1-c1cc(CN2C(=O)NC(C)(c3ccc(F)cc3)C2=O)on1 |
| InChI | InChI=1S/C21H18FN3O4/c1-21(13-7-9-14(22)10-8-13)19(26)25(20(27)23-21)12-15-11-17(24-29-15)16-5-3-4-6-18(16)28-2/h3-11H,12H2,1-2H3,(H,23,27) |
| InChIKey | WPFSMDJCJZFFTM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|