C22H20ClN3O4S — CID 24593361
3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 24593361) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24593361 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(C)NC(=O)N(Cc3csc(-c4ccccc4Cl)n3)C2=O)cc1OC |
| InChI | InChI=1S/C22H20ClN3O4S/c1-22(13-8-9-17(29-2)18(10-13)30-3)20(27)26(21(28)25-22)11-14-12-31-19(24-14)15-6-4-5-7-16(15)23/h4-10,12H,11H2,1-3H3,(H,25,28) |
| InChIKey | AWKVBCGXLNJCSE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|