C23H23N3O4S — CID 24576766
3-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 24576766) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24576766 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 3-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccccc2)NC(=O)N(Cc2csc(-c3ccc(OC)c(OC)c3)n2)C1=O |
| InChI | InChI=1S/C23H23N3O4S/c1-4-23(16-8-6-5-7-9-16)21(27)26(22(28)25-23)13-17-14-31-20(24-17)15-10-11-18(29-2)19(12-15)30-3/h5-12,14H,4,13H2,1-3H3,(H,25,28) |
| InChIKey | IQZQBBNPDFGQIP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|