C26H21N3O3S — CID 17402829
3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 17402829) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17402829 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1-c1nc(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cs1 |
| InChI | InChI=1S/C26H21N3O3S/c1-32-22-15-9-8-14-21(22)23-27-20(17-33-23)16-29-24(30)26(28-25(29)31,18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,17H,16H2,1H3,(H,28,31) |
| InChIKey | VYQAGWPOPVFVSF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|