C12H12BrNOS — CID 82094625
4-(2-bromoethyl)-2-(2-methoxyphenyl)-1,3-thiazole (PubChem CID 82094625) has the molecular formula C12H12BrNOS and a molecular weight of 298.20 g/mol. Its IUPAC name is 4-(2-bromoethyl)-2-(2-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(2-bromoethyl)-2-(2-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82094625 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-(2-bromoethyl)-2-(2-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccccc1-c1nc(CCBr)cs1 |
| InChI | InChI=1S/C12H12BrNOS/c1-15-11-5-3-2-4-10(11)12-14-9(6-7-13)8-16-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | GUSHDASYFYMGRD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|