C20H19N3O5S — CID 51116154
3-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 51116154) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51116154 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc(-c2nc(CN3C(=O)NC(C)(c4ccco4)C3=O)cs2)c1OC |
| InChI | InChI=1S/C20H19N3O5S/c1-20(15-8-5-9-28-15)18(24)23(19(25)22-20)10-12-11-29-17(21-12)13-6-4-7-14(26-2)16(13)27-3/h4-9,11H,10H2,1-3H3,(H,22,25) |
| InChIKey | AYZXGAXKCNSJGZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|