C18H13F2N3O3S — CID 55529112
5-(2,5-difluorophenyl)-3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 55529112) has the molecular formula C18H13F2N3O3S and a molecular weight of 389.38 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55529112 |
| Molecular Formula | C18H13F2N3O3S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 5-(2,5-difluorophenyl)-3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(Cc2csc(-c3ccco3)n2)C1=O |
| InChI | InChI=1S/C18H13F2N3O3S/c1-18(12-7-10(19)4-5-13(12)20)16(24)23(17(25)22-18)8-11-9-27-15(21-11)14-3-2-6-26-14/h2-7,9H,8H2,1H3,(H,22,25) |
| InChIKey | UTMMDRVSPDMUKN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|