C21H18FN3O2S — CID 51537328
(5S)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 51537328) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is (5S)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51537328 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (5S)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(Cc3csc(-c4ccc(F)cc4)n3)C2=O)cc1 |
| InChI | InChI=1S/C21H18FN3O2S/c1-13-3-7-15(8-4-13)21(2)19(26)25(20(27)24-21)11-17-12-28-18(23-17)14-5-9-16(22)10-6-14/h3-10,12H,11H2,1-2H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | OWQUFBCNXWICFW-NRFANRHFSA-N |
| XLogP | 4.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|