C21H21N3O2S2 — CID 84878946
5-methyl-5-(4-propan-2-ylphenyl)-3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 84878946) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-methyl-5-(4-propan-2-ylphenyl)-3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(4-propan-2-ylphenyl)-3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84878946 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-methyl-5-(4-propan-2-ylphenyl)-3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C2(C)NC(=O)N(Cc3csc(-c4ccsc4)n3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O2S2/c1-13(2)14-4-6-16(7-5-14)21(3)19(25)24(20(26)23-21)10-17-12-28-18(22-17)15-8-9-27-11-15/h4-9,11-13H,10H2,1-3H3,(H,23,26) |
| InChIKey | OHPQGRFNNSTWHQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|