C21H18ClN3O3S — CID 18284857
5-(4-chlorophenyl)-3-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 18284857) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18284857 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(-c2nc(CN3C(=O)NC(C)(c4ccc(Cl)cc4)C3=O)cs2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-21(14-5-7-15(22)8-6-14)19(26)25(20(27)24-21)11-16-12-29-18(23-16)13-3-9-17(28-2)10-4-13/h3-10,12H,11H2,1-2H3,(H,24,27) |
| InChIKey | DILLQGZGRJDHKI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|