C20H15Cl2N3O2S — CID 2122122
(5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 2122122) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2122122 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc(Cl)cc2Cl)NC(=O)N(Cc2csc(-c3ccccc3)n2)C1=O |
| InChI | InChI=1S/C20H15Cl2N3O2S/c1-20(15-8-7-13(21)9-16(15)22)18(26)25(19(27)24-20)10-14-11-28-17(23-14)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | DYOMKSKGMQGFNN-FQEVSTJZSA-N |
| XLogP | 5.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|