C15H11Cl2N3O4S — CID 60524466
5-(2,4-dichlorophenyl)-5-methyl-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 60524466) has the molecular formula C15H11Cl2N3O4S and a molecular weight of 400.24 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-methyl-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60524466 |
| Molecular Formula | C15H11Cl2N3O4S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(Cc2csc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C15H11Cl2N3O4S/c1-15(10-3-2-9(16)5-11(10)17)13(21)19(14(22)18-15)6-8-4-12(20(23)24)25-7-8/h2-5,7H,6H2,1H3,(H,18,22) |
| InChIKey | YCSYDAJOZFFDKK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|