C14H13N3O5S — CID 95282818
(5S)-5-methyl-5-(5-methylfuran-2-yl)-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 95282818) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is (5S)-5-methyl-5-(5-methylfuran-2-yl)-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-(5-methylfuran-2-yl)-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95282818 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (5S)-5-methyl-5-(5-methylfuran-2-yl)-3-[(5-nitrothiophen-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(Cc3csc([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C14H13N3O5S/c1-8-3-4-10(22-8)14(2)12(18)16(13(19)15-14)6-9-5-11(17(20)21)23-7-9/h3-5,7H,6H2,1-2H3,(H,15,19)/t14-/m0/s1 |
| InChIKey | COLAENGMHRIZOI-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|