C14H15N3O4S — CID 167945121
3-[(3-methoxy-1,2-thiazol-4-yl)methyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione (PubChem CID 167945121) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-[(3-methoxy-1,2-thiazol-4-yl)methyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione.
| Compound Name | 3-[(3-methoxy-1,2-thiazol-4-yl)methyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167945121 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-[(3-methoxy-1,2-thiazol-4-yl)methyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione |
| SMILES | COc1nscc1CN1C(=O)NC(C)(c2ccc(C)o2)C1=O |
| InChI | InChI=1S/C14H15N3O4S/c1-8-4-5-10(21-8)14(2)12(18)17(13(19)15-14)6-9-7-22-16-11(9)20-3/h4-5,7H,6H2,1-3H3,(H,15,19) |
| InChIKey | IYIABZUDFLHZQE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|