C17H15FN2O4 — CID 94814004
(5S)-3-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione (PubChem CID 94814004) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is (5S)-3-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94814004 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (5S)-3-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-5-(5-methylfuran-2-yl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)c3ccc(F)cc3)C2=O)o1 |
| InChI | InChI=1S/C17H15FN2O4/c1-10-3-8-14(24-10)17(2)15(22)20(16(23)19-17)9-13(21)11-4-6-12(18)7-5-11/h3-8H,9H2,1-2H3,(H,19,23)/t17-/m0/s1 |
| InChIKey | XRSOMTIDNZCPJS-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|