C12H13N3O4S — CID 47295024
3-[(5-nitrothiophen-3-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 47295024) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-[(5-nitrothiophen-3-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(5-nitrothiophen-3-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 47295024 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-[(5-nitrothiophen-3-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O4S/c16-10-12(3-1-2-4-12)13-11(17)14(10)6-8-5-9(15(18)19)20-7-8/h5,7H,1-4,6H2,(H,13,17) |
| InChIKey | FTKOYKGFPGWYIR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|