C21H18BrN3O3S — CID 55356802
5-(2-bromophenyl)-3-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 55356802) has the molecular formula C21H18BrN3O3S and a molecular weight of 472.36 g/mol. Its IUPAC name is 5-(2-bromophenyl)-3-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2-bromophenyl)-3-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55356802 |
| Molecular Formula | C21H18BrN3O3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 5-(2-bromophenyl)-3-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc(-c2nc(CN3C(=O)NC(C)(c4ccccc4Br)C3=O)cs2)c1 |
| InChI | InChI=1S/C21H18BrN3O3S/c1-21(16-8-3-4-9-17(16)22)19(26)25(20(27)24-21)11-14-12-29-18(23-14)13-6-5-7-15(10-13)28-2/h3-10,12H,11H2,1-2H3,(H,24,27) |
| InChIKey | RRVFLRRZAMVFPV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|