C18H17BrN2O3 — CID 40794994
(5S)-5-(2-bromophenyl)-3-[(3-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 40794994) has the molecular formula C18H17BrN2O3 and a molecular weight of 389.25 g/mol. Its IUPAC name is (5S)-5-(2-bromophenyl)-3-[(3-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2-bromophenyl)-3-[(3-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40794994 |
| Molecular Formula | C18H17BrN2O3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (5S)-5-(2-bromophenyl)-3-[(3-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc(CN2C(=O)N[C@@](C)(c3ccccc3Br)C2=O)c1 |
| InChI | InChI=1S/C18H17BrN2O3/c1-18(14-8-3-4-9-15(14)19)16(22)21(17(23)20-18)11-12-6-5-7-13(10-12)24-2/h3-10H,11H2,1-2H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | QBRULNHRTCYUEK-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|