C23H24BrN3O4 — CID 47094416
2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 47094416) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 47094416 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CN(C(=O)CN2C(=O)NC(C)(c3ccccc3Br)C2=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H24BrN3O4/c1-23(18-5-3-4-6-19(18)24)21(29)27(22(30)25-23)14-20(28)26(16-9-10-16)13-15-7-11-17(31-2)12-8-15/h3-8,11-12,16H,9-10,13-14H2,1-2H3,(H,25,30) |
| InChIKey | GEZABJXRFIOXAG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|