C19H15BrN4O3 — CID 78878886
5-(2-bromophenyl)-5-methyl-3-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 78878886) has the molecular formula C19H15BrN4O3 and a molecular weight of 427.26 g/mol. Its IUPAC name is 5-(2-bromophenyl)-5-methyl-3-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2-bromophenyl)-5-methyl-3-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78878886 |
| Molecular Formula | C19H15BrN4O3 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 5-(2-bromophenyl)-5-methyl-3-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2Br)NC(=O)N(Cc2noc(-c3ccccc3)n2)C1=O |
| InChI | InChI=1S/C19H15BrN4O3/c1-19(13-9-5-6-10-14(13)20)17(25)24(18(26)22-19)11-15-21-16(27-23-15)12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,22,26) |
| InChIKey | IHNXLYKXTCABRO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|