C21H17Cl2N3O4 — CID 24576784
5-(2,4-dichlorophenyl)-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 24576784) has the molecular formula C21H17Cl2N3O4 and a molecular weight of 446.29 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24576784 |
| Molecular Formula | C21H17Cl2N3O4 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(-c2cc(CN3C(=O)NC(C)(c4ccc(Cl)cc4Cl)C3=O)on2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O4/c1-21(16-8-5-13(22)9-17(16)23)19(27)26(20(28)24-21)11-15-10-18(25-30-15)12-3-6-14(29-2)7-4-12/h3-10H,11H2,1-2H3,(H,24,28) |
| InChIKey | IYNNUSLEGNRMDP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|