C18H19N3O5 — CID 24577195
1-butyl-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 24577195) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 1-butyl-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 24577195 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-butyl-3-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(Cc2cc(-c3ccc(OC)cc3)no2)C1=O |
| InChI | InChI=1S/C18H19N3O5/c1-3-4-9-20-16(22)17(23)21(18(20)24)11-14-10-15(19-26-14)12-5-7-13(25-2)8-6-12/h5-8,10H,3-4,9,11H2,1-2H3 |
| InChIKey | XJPRYHILWLJOAI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|