C17H20N2O6 — CID 7738319
1-butyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 7738319) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-butyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7738319 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-butyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)c2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C17H20N2O6/c1-4-5-8-18-15(21)16(22)19(17(18)23)10-13(20)12-7-6-11(24-2)9-14(12)25-3/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | JCYVQKZDZMHFSD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|