C18H23NO3S — CID 69324150
2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 69324150) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 69324150 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | CCCCN1C(C)=CSC1=CC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H23NO3S/c1-5-6-9-19-13(2)12-23-18(19)11-16(20)15-8-7-14(21-3)10-17(15)22-4/h7-8,10-12H,5-6,9H2,1-4H3 |
| InChIKey | HDCSAXHEZWOZFB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|