C22H26ClNO3S — CID 69322537
2-[3-butyl-5-(3-hydroxy-3-methylbut-1-ynyl)-4-methyl-1,3-thiazol-2-ylidene]-1-(5-chloro-2-methoxyphenyl)ethanone (PubChem CID 69322537) has the molecular formula C22H26ClNO3S and a molecular weight of 419.97 g/mol. Its IUPAC name is 2-[3-butyl-5-(3-hydroxy-3-methylbut-1-ynyl)-4-methyl-1,3-thiazol-2-ylidene]-1-(5-chloro-2-methoxyphenyl)ethanone.
| Compound Name | 2-[3-butyl-5-(3-hydroxy-3-methylbut-1-ynyl)-4-methyl-1,3-thiazol-2-ylidene]-1-(5-chloro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 69322537 |
| Molecular Formula | C22H26ClNO3S |
| Molecular Weight | 419.97 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[3-butyl-5-(3-hydroxy-3-methylbut-1-ynyl)-4-methyl-1,3-thiazol-2-ylidene]-1-(5-chloro-2-methoxyphenyl)ethanone |
| SMILES | CCCCN1C(=CC(=O)c2cc(Cl)ccc2OC)SC(C#CC(C)(C)O)=C1C |
| InChI | InChI=1S/C22H26ClNO3S/c1-6-7-12-24-15(2)20(10-11-22(3,4)26)28-21(24)14-18(25)17-13-16(23)8-9-19(17)27-5/h8-9,13-14,26H,6-7,12H2,1-5H3 |
| InChIKey | VAIMNGAFCIDZOP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|