C21H29ClN2O2S — CID 24955353
(2Z)-2-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 24955353) has the molecular formula C21H29ClN2O2S and a molecular weight of 409.00 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | (2Z)-2-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24955353 |
| Molecular Formula | C21H29ClN2O2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (2Z)-2-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | CCCCN1C(C)=C(C(C)(C)C)S/C1=C\C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H29ClN2O2S/c1-7-8-11-24-14(2)20(21(3,4)5)27-19(24)13-18(25)23-16-12-15(22)9-10-17(16)26-6/h9-10,12-13H,7-8,11H2,1-6H3,(H,23,25)/b19-13- |
| InChIKey | QBEIINMZRQIZJM-UYRXBGFRSA-N |
| XLogP | 6.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|