C21H32ClNO4 — CID 91722643
nonyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate (PubChem CID 91722643) has the molecular formula C21H32ClNO4 and a molecular weight of 397.94 g/mol. Its IUPAC name is nonyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate.
| Compound Name | nonyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 91722643 |
| Molecular Formula | C21H32ClNO4 |
| Molecular Weight | 397.94 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | nonyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate |
| SMILES | CCCCCCCCCOC(=O)CCCC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H32ClNO4/c1-3-4-5-6-7-8-9-15-27-21(25)12-10-11-20(24)23-18-16-17(22)13-14-19(18)26-2/h13-14,16H,3-12,15H2,1-2H3,(H,23,24) |
| InChIKey | IHKKLQJXTJDSLF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|