C23H30ClNO4 — CID 4733029
N-(5-chloro-2-methoxyphenyl)-2-(4-octoxyphenoxy)acetamide (PubChem CID 4733029) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(4-octoxyphenoxy)acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(4-octoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 4733029 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(4-octoxyphenoxy)acetamide |
| SMILES | CCCCCCCCOc1ccc(OCC(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C23H30ClNO4/c1-3-4-5-6-7-8-15-28-19-10-12-20(13-11-19)29-17-23(26)25-21-16-18(24)9-14-22(21)27-2/h9-14,16H,3-8,15,17H2,1-2H3,(H,25,26) |
| InChIKey | PAPORYSZKDXPNL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|