C17H24ClNO4 — CID 91722639
pentyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate (PubChem CID 91722639) has the molecular formula C17H24ClNO4 and a molecular weight of 341.83 g/mol. Its IUPAC name is pentyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate.
| Compound Name | pentyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 91722639 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | pentyl 5-(5-chloro-2-methoxyanilino)-5-oxopentanoate |
| SMILES | CCCCCOC(=O)CCCC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H24ClNO4/c1-3-4-5-11-23-17(21)8-6-7-16(20)19-14-12-13(18)9-10-15(14)22-2/h9-10,12H,3-8,11H2,1-2H3,(H,19,20) |
| InChIKey | LGPIFVUFENFBFL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|