C20H20ClFN2O5 — CID 17261210
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate (PubChem CID 17261210) has the molecular formula C20H20ClFN2O5 and a molecular weight of 422.84 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 17261210 |
| Molecular Formula | C20H20ClFN2O5 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CCCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20ClFN2O5/c1-28-17-10-5-13(21)11-16(17)24-19(26)12-29-20(27)4-2-3-18(25)23-15-8-6-14(22)7-9-15/h5-11H,2-4,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MZLBPOPELPVQPJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |