C20H25ClFNO2S — CID 69321449
(2E)-2-(3-butyl-4-tert-butyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-methoxyphenyl)-2-fluoroethanone (PubChem CID 69321449) has the molecular formula C20H25ClFNO2S and a molecular weight of 397.94 g/mol. Its IUPAC name is (2E)-2-(3-butyl-4-tert-butyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-methoxyphenyl)-2-fluoroethanone.
| Compound Name | (2E)-2-(3-butyl-4-tert-butyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-methoxyphenyl)-2-fluoroethanone |
|---|---|
| PubChem CID | 69321449 |
| Molecular Formula | C20H25ClFNO2S |
| Molecular Weight | 397.94 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2E)-2-(3-butyl-4-tert-butyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-methoxyphenyl)-2-fluoroethanone |
| SMILES | CCCCN1C(C(C)(C)C)=CS/C1=C(/F)C(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C20H25ClFNO2S/c1-6-7-10-23-16(20(2,3)4)12-26-19(23)17(22)18(24)14-11-13(21)8-9-15(14)25-5/h8-9,11-12H,6-7,10H2,1-5H3/b19-17+ |
| InChIKey | HBCVQZASXDBTGJ-HTXNQAPBSA-N |
| XLogP | 6.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.94 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|