C22H31ClN4O3S — CID 25171868
tert-butyl N-[(Z)-[[(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)amino]-(5-chloro-2-methoxyphenyl)methylidene]amino]carbamate (PubChem CID 25171868) has the molecular formula C22H31ClN4O3S and a molecular weight of 467.04 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[[(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)amino]-(5-chloro-2-methoxyphenyl)methylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[[(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)amino]-(5-chloro-2-methoxyphenyl)methylidene]amino]carbamate |
|---|---|
| PubChem CID | 25171868 |
| Molecular Formula | C22H31ClN4O3S |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tert-butyl N-[(Z)-[[(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)amino]-(5-chloro-2-methoxyphenyl)methylidene]amino]carbamate |
| SMILES | CCCCn1c(C)c(C)s/c1=N\C(=N/NC(=O)OC(C)(C)C)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C22H31ClN4O3S/c1-8-9-12-27-14(2)15(3)31-20(27)24-19(25-26-21(28)30-22(4,5)6)17-13-16(23)10-11-18(17)29-7/h10-11,13H,8-9,12H2,1-7H3,(H,26,28)/b24-20-,25-19- |
| InChIKey | ZJDPNQRZZSXBJI-AZWNULDESA-N |
| XLogP | 5.42 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|