C21H30ClN3O2S — CID 25169594
N-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-5-chloro-N',2-dimethoxybenzenecarboximidamide (PubChem CID 25169594) has the molecular formula C21H30ClN3O2S and a molecular weight of 424.01 g/mol. Its IUPAC name is N-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-5-chloro-N',2-dimethoxybenzenecarboximidamide.
| Compound Name | N-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-5-chloro-N',2-dimethoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25169594 |
| Molecular Formula | C21H30ClN3O2S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-(3-butyl-5-tert-butyl-4-methyl-1,3-thiazol-2-ylidene)-5-chloro-N',2-dimethoxybenzenecarboximidamide |
| SMILES | CCCCn1c(C)c(C(C)(C)C)s/c1=N\C(=N/OC)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H30ClN3O2S/c1-8-9-12-25-14(2)18(21(3,4)5)28-20(25)23-19(24-27-7)16-13-15(22)10-11-17(16)26-6/h10-11,13H,8-9,12H2,1-7H3/b23-20-,24-19- |
| InChIKey | SOASGSSMJYTWPF-IMTZVKBRSA-N |
| XLogP | 5.53 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|