C21H20ClN3O5 — CID 2481720
2-butyl-N-(5-chloro-2-methoxybenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide (PubChem CID 2481720) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is 2-butyl-N-(5-chloro-2-methoxybenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-(5-chloro-2-methoxybenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2481720 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-butyl-N-(5-chloro-2-methoxybenzoyl)imino-1,3-dihydroxyisoindole-5-carboxamide |
| SMILES | CCCCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3cc(Cl)ccc3OC)cc2c1O |
| InChI | InChI=1S/C21H20ClN3O5/c1-3-4-9-25-20(28)14-7-5-12(10-15(14)21(25)29)18(26)23-24-19(27)16-11-13(22)6-8-17(16)30-2/h5-8,10-11,28-29H,3-4,9H2,1-2H3/b24-23+ |
| InChIKey | XOCCYTUHHHCRNB-WCWDXBQESA-N |
| XLogP | 4.95 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|