C17H19ClN2O4S — CID 68623405
N-[5-acetyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-5-chloro-2-methoxybenzamide (PubChem CID 68623405) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[5-acetyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-5-chloro-2-methoxybenzamide.
| Compound Name | N-[5-acetyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 68623405 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[5-acetyl-3-(2-methoxyethyl)-4-methyl-1,3-thiazol-2-ylidene]-5-chloro-2-methoxybenzamide |
| SMILES | COCCn1c(C)c(C(C)=O)s/c1=N\C(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H19ClN2O4S/c1-10-15(11(2)21)25-17(20(10)7-8-23-3)19-16(22)13-9-12(18)5-6-14(13)24-4/h5-6,9H,7-8H2,1-4H3/b19-17- |
| InChIKey | WCNPIZOWCQXFPR-ZPHPHTNESA-N |
| XLogP | 3.11 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|