C21H21ClN2O3S — CID 126205417
5-chloro-N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]-2-methoxybenzamide (PubChem CID 126205417) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is 5-chloro-N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]-2-methoxybenzamide |
|---|---|
| PubChem CID | 126205417 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-chloro-N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]-2-methoxybenzamide |
| SMILES | CCc1s/c(=N\C(=O)c2cc(Cl)ccc2OC)n(C)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-5-18-19(13-6-9-15(26-3)10-7-13)24(2)21(28-18)23-20(25)16-12-14(22)8-11-17(16)27-4/h6-12H,5H2,1-4H3/b23-21- |
| InChIKey | HLCQBLWMESGVHH-LNVKXUELSA-N |
| XLogP | 4.73 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|