C23H25FN2O2S — CID 126212851
4-butoxy-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 126212851) has the molecular formula C23H25FN2O2S and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-butoxy-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 4-butoxy-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 126212851 |
| Molecular Formula | C23H25FN2O2S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-butoxy-N-[5-ethyl-4-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc(CC)c(-c3ccc(F)cc3)n2C)cc1 |
| InChI | InChI=1S/C23H25FN2O2S/c1-4-6-15-28-19-13-9-17(10-14-19)22(27)25-23-26(3)21(20(5-2)29-23)16-7-11-18(24)12-8-16/h7-14H,4-6,15H2,1-3H3/b25-23- |
| InChIKey | ZBQFEESDUOLYMG-BZZOAKBMSA-N |
| XLogP | 5.38 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|